C20H29N3O4 — CID 52520902
(2S)-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2-prop-2-enoxypropanamide (PubChem CID 52520902) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S)-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2-prop-2-enoxypropanamide.
| Compound Name | (2S)-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2-prop-2-enoxypropanamide |
|---|---|
| PubChem CID | 52520902 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (2S)-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-2-prop-2-enoxypropanamide |
| SMILES | C=CCO[C@@H](C)C(=O)N(CC)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H29N3O4/c1-4-12-27-16(3)20(25)22(5-2)15-19(24)21-17-6-8-18(9-7-17)23-10-13-26-14-11-23/h4,6-9,16H,1,5,10-15H2,2-3H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | JEUSEWAYIPQLLH-INIZCTEOSA-N |
| XLogP | 1.90 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|