C24H31N3O5 — CID 55342225
2-[[2-(2-ethoxyphenoxy)acetyl]-ethylamino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 55342225) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[[2-(2-ethoxyphenoxy)acetyl]-ethylamino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[[2-(2-ethoxyphenoxy)acetyl]-ethylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55342225 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 2-[[2-(2-ethoxyphenoxy)acetyl]-ethylamino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCOc1ccccc1OCC(=O)N(CC)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H31N3O5/c1-3-26(24(29)18-32-22-8-6-5-7-21(22)31-4-2)17-23(28)25-19-9-11-20(12-10-19)27-13-15-30-16-14-27/h5-12H,3-4,13-18H2,1-2H3,(H,25,28) |
| InChIKey | DPLNKRVABJNYJK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|