C23H29N3O5 — CID 4044574
2-[ethyl-[2-(2-methoxyphenoxy)acetyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 4044574) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[ethyl-[2-(2-methoxyphenoxy)acetyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[ethyl-[2-(2-methoxyphenoxy)acetyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4044574 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 2-[ethyl-[2-(2-methoxyphenoxy)acetyl]amino]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=O)COc1ccccc1OC |
| InChI | InChI=1S/C23H29N3O5/c1-3-25(23(28)17-31-21-7-5-4-6-20(21)29-2)16-22(27)24-18-8-10-19(11-9-18)26-12-14-30-15-13-26/h4-11H,3,12-17H2,1-2H3,(H,24,27) |
| InChIKey | RDPHGLPSHUJTQF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|