C22H26N2O6 — CID 8913367
[(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenoxy)acetate (PubChem CID 8913367) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 8913367 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)O[C@H](C)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H26N2O6/c1-16(30-21(25)15-29-20-6-4-3-5-19(20)27-2)22(26)23-17-7-9-18(10-8-17)24-11-13-28-14-12-24/h3-10,16H,11-15H2,1-2H3,(H,23,26)/t16-/m1/s1 |
| InChIKey | SMJOFJHQHRQHPC-MRXNPFEDSA-N |
| XLogP | 2.48 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|