C19H28N4O4 — CID 52521310
(2R)-1-[3-(1,3-benzodioxol-5-ylmethylcarbamoylamino)propyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 52521310) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is (2R)-1-[3-(1,3-benzodioxol-5-ylmethylcarbamoylamino)propyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[3-(1,3-benzodioxol-5-ylmethylcarbamoylamino)propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 52521310 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (2R)-1-[3-(1,3-benzodioxol-5-ylmethylcarbamoylamino)propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)[C@H]1CCCN1CCCNC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H28N4O4/c1-22(2)18(24)15-5-3-9-23(15)10-4-8-20-19(25)21-12-14-6-7-16-17(11-14)27-13-26-16/h6-7,11,15H,3-5,8-10,12-13H2,1-2H3,(H2,20,21,25)/t15-/m1/s1 |
| InChIKey | XPJJDVVNXYBDTP-OAHLLOKOSA-N |
| XLogP | 1.16 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|