C34H22N8 — CID 5252184
1-[2,4,5-tris(pyrrolo[2,3-b]pyridin-1-yl)phenyl]pyrrolo[2,3-b]pyridine (PubChem CID 5252184) has the molecular formula C34H22N8 and a molecular weight of 542.61 g/mol. Its IUPAC name is 1-[2,4,5-tris(pyrrolo[2,3-b]pyridin-1-yl)phenyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 1-[2,4,5-tris(pyrrolo[2,3-b]pyridin-1-yl)phenyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 5252184 |
| Molecular Formula | C34H22N8 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 1-[2,4,5-tris(pyrrolo[2,3-b]pyridin-1-yl)phenyl]pyrrolo[2,3-b]pyridine |
| SMILES | c1cnc2c(c1)ccn2-c1cc(-n2ccc3cccnc32)c(-n2ccc3cccnc32)cc1-n1ccc2cccnc21 |
| InChI | InChI=1S/C34H22N8/c1-5-23-9-17-39(31(23)35-13-1)27-21-29(41-19-11-25-7-3-15-37-33(25)41)30(42-20-12-26-8-4-16-38-34(26)42)22-28(27)40-18-10-24-6-2-14-36-32(24)40/h1-22H |
| InChIKey | UWHZBJQPWJMCKM-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |