C15H21N3O5S — CID 52522731
methyl (2S)-2-[[3-(dimethylsulfamoyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 52522731) has the molecular formula C15H21N3O5S and a molecular weight of 355.42 g/mol. Its IUPAC name is methyl (2S)-2-[[3-(dimethylsulfamoyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | methyl (2S)-2-[[3-(dimethylsulfamoyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 52522731 |
| Molecular Formula | C15H21N3O5S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | methyl (2S)-2-[[3-(dimethylsulfamoyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCC[C@H]1C(=O)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H21N3O5S/c1-17(2)24(21,22)12-7-4-6-11(10-12)16-14(19)13-8-5-9-18(13)15(20)23-3/h4,6-7,10,13H,5,8-9H2,1-3H3,(H,16,19)/t13-/m0/s1 |
| InChIKey | GEMGSPCHHPECJS-ZDUSSCGKSA-N |
| XLogP | 1.11 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |