C20H23N5O4 — CID 52522831
N-methyl-N-[(1S)-1-(3-nitrophenyl)ethyl]-2-(1,4,6-trimethylpyrazolo[5,4-b]pyridin-3-yl)oxyacetamide (PubChem CID 52522831) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is N-methyl-N-[(1S)-1-(3-nitrophenyl)ethyl]-2-(1,4,6-trimethylpyrazolo[5,4-b]pyridin-3-yl)oxyacetamide.
| Compound Name | N-methyl-N-[(1S)-1-(3-nitrophenyl)ethyl]-2-(1,4,6-trimethylpyrazolo[5,4-b]pyridin-3-yl)oxyacetamide |
|---|---|
| PubChem CID | 52522831 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-methyl-N-[(1S)-1-(3-nitrophenyl)ethyl]-2-(1,4,6-trimethylpyrazolo[5,4-b]pyridin-3-yl)oxyacetamide |
| SMILES | Cc1cc(C)c2c(OCC(=O)N(C)[C@@H](C)c3cccc([N+](=O)[O-])c3)nn(C)c2n1 |
| InChI | InChI=1S/C20H23N5O4/c1-12-9-13(2)21-19-18(12)20(22-24(19)5)29-11-17(26)23(4)14(3)15-7-6-8-16(10-15)25(27)28/h6-10,14H,11H2,1-5H3/t14-/m0/s1 |
| InChIKey | ZKEHVQZLWITMKQ-AWEZNQCLSA-N |
| XLogP | 3.09 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|