C22H22FN5O3 — CID 52523816
ethyl (3S)-3-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]-2-phenyl-3,4-dihydropyrazole-5-carboxylate (PubChem CID 52523816) has the molecular formula C22H22FN5O3 and a molecular weight of 423.45 g/mol. Its IUPAC name is ethyl (3S)-3-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]-2-phenyl-3,4-dihydropyrazole-5-carboxylate.
| Compound Name | ethyl (3S)-3-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
|---|---|
| PubChem CID | 52523816 |
| Molecular Formula | C22H22FN5O3 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | ethyl (3S)-3-[2-(2-cyano-3-fluoroanilino)ethylcarbamoyl]-2-phenyl-3,4-dihydropyrazole-5-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)[C@H](C(=O)NCCNc2cccc(F)c2C#N)C1 |
| InChI | InChI=1S/C22H22FN5O3/c1-2-31-22(30)19-13-20(28(27-19)15-7-4-3-5-8-15)21(29)26-12-11-25-18-10-6-9-17(23)16(18)14-24/h3-10,20,25H,2,11-13H2,1H3,(H,26,29)/t20-/m0/s1 |
| InChIKey | WVFBHNVANQPKEF-FQEVSTJZSA-N |
| XLogP | 2.42 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|