C14H16F3N3O6 — CID 52523891
[(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(2,2,2-trifluoroethylamino)acetate (PubChem CID 52523891) has the molecular formula C14H16F3N3O6 and a molecular weight of 379.29 g/mol. Its IUPAC name is [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(2,2,2-trifluoroethylamino)acetate.
| Compound Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(2,2,2-trifluoroethylamino)acetate |
|---|---|
| PubChem CID | 52523891 |
| Molecular Formula | C14H16F3N3O6 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 2-(2,2,2-trifluoroethylamino)acetate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)OC(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O6/c1-8(26-12(21)6-18-7-14(15,16)17)13(22)19-10-5-9(20(23)24)3-4-11(10)25-2/h3-5,8,18H,6-7H2,1-2H3,(H,19,22)/t8-/m1/s1 |
| InChIKey | HTQZPPOKBHMJFS-MRVPVSSYSA-N |
| XLogP | 1.63 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|