C12H23F3N4 — CID 52525239
1-[(2R)-butan-2-yl]-2-[[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine (PubChem CID 52525239) has the molecular formula C12H23F3N4 and a molecular weight of 280.34 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-2-[[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-[(2R)-butan-2-yl]-2-[[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 52525239 |
| Molecular Formula | C12H23F3N4 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-2-[[(3S)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]guanidine |
| SMILES | CC[C@@H](C)N/C(N)=N/C[C@H]1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C12H23F3N4/c1-3-9(2)18-11(16)17-6-10-4-5-19(7-10)8-12(13,14)15/h9-10H,3-8H2,1-2H3,(H3,16,17,18)/t9-,10-/m1/s1 |
| InChIKey | RWROXPUIWDXNGZ-NXEZZACHSA-N |
| XLogP | 1.57 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|