C12H23F3N4 — CID 56801273
N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyrrolidine-1-carboximidamide (PubChem CID 56801273) has the molecular formula C12H23F3N4 and a molecular weight of 280.34 g/mol. Its IUPAC name is N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 56801273 |
| Molecular Formula | C12H23F3N4 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N'-methyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCN(C)CC(F)(F)F)N1CCCC1 |
| InChI | InChI=1S/C12H23F3N4/c1-16-11(19-8-3-4-9-19)17-6-5-7-18(2)10-12(13,14)15/h3-10H2,1-2H3,(H,16,17) |
| InChIKey | WOEPBIDMBNDLBZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|