C17H23F2N3O4S — CID 52526985
3-[(3R)-1-[2-[2-(difluoromethylsulfonyl)anilino]-2-oxoethyl]piperidin-3-yl]propanamide (PubChem CID 52526985) has the molecular formula C17H23F2N3O4S and a molecular weight of 403.45 g/mol. Its IUPAC name is 3-[(3R)-1-[2-[2-(difluoromethylsulfonyl)anilino]-2-oxoethyl]piperidin-3-yl]propanamide.
| Compound Name | 3-[(3R)-1-[2-[2-(difluoromethylsulfonyl)anilino]-2-oxoethyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 52526985 |
| Molecular Formula | C17H23F2N3O4S |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 3-[(3R)-1-[2-[2-(difluoromethylsulfonyl)anilino]-2-oxoethyl]piperidin-3-yl]propanamide |
| SMILES | NC(=O)CC[C@H]1CCCN(CC(=O)Nc2ccccc2S(=O)(=O)C(F)F)C1 |
| InChI | InChI=1S/C17H23F2N3O4S/c18-17(19)27(25,26)14-6-2-1-5-13(14)21-16(24)11-22-9-3-4-12(10-22)7-8-15(20)23/h1-2,5-6,12,17H,3-4,7-11H2,(H2,20,23)(H,21,24)/t12-/m1/s1 |
| InChIKey | MSMVKWXZUSVTJQ-GFCCVEGCSA-N |
| XLogP | 1.60 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |