C24H28N4O — CID 52527257
(3R)-3-[[methyl(pyridin-3-ylmethyl)amino]methyl]-N-naphthalen-1-ylpiperidine-1-carboxamide (PubChem CID 52527257) has the molecular formula C24H28N4O and a molecular weight of 388.51 g/mol. Its IUPAC name is (3R)-3-[[methyl(pyridin-3-ylmethyl)amino]methyl]-N-naphthalen-1-ylpiperidine-1-carboxamide.
| Compound Name | (3R)-3-[[methyl(pyridin-3-ylmethyl)amino]methyl]-N-naphthalen-1-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 52527257 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (3R)-3-[[methyl(pyridin-3-ylmethyl)amino]methyl]-N-naphthalen-1-ylpiperidine-1-carboxamide |
| SMILES | CN(Cc1cccnc1)C[C@H]1CCCN(C(=O)Nc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C24H28N4O/c1-27(16-19-7-5-13-25-15-19)17-20-8-6-14-28(18-20)24(29)26-23-12-4-10-21-9-2-3-11-22(21)23/h2-5,7,9-13,15,20H,6,8,14,16-18H2,1H3,(H,26,29)/t20-/m1/s1 |
| InChIKey | VTJAJAIGHWSCPL-HXUWFJFHSA-N |
| XLogP | 4.61 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |