C25H24N2O5S — CID 52527565
[4-[4-[5-(dimethylsulfamoyl)-2,3-dihydroindole-1-carbonyl]phenyl]phenyl] acetate (PubChem CID 52527565) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is [4-[4-[5-(dimethylsulfamoyl)-2,3-dihydroindole-1-carbonyl]phenyl]phenyl] acetate.
| Compound Name | [4-[4-[5-(dimethylsulfamoyl)-2,3-dihydroindole-1-carbonyl]phenyl]phenyl] acetate |
|---|---|
| PubChem CID | 52527565 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [4-[4-[5-(dimethylsulfamoyl)-2,3-dihydroindole-1-carbonyl]phenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C(=O)N3CCc4cc(S(=O)(=O)N(C)C)ccc43)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O5S/c1-17(28)32-22-10-8-19(9-11-22)18-4-6-20(7-5-18)25(29)27-15-14-21-16-23(12-13-24(21)27)33(30,31)26(2)3/h4-13,16H,14-15H2,1-3H3 |
| InChIKey | XPHNRZJXENNGDE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|