C13H17N3O2S2 — CID 52530135
(3R,7aS)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 52530135) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (3R,7aS)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3R,7aS)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 52530135 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (3R,7aS)-N-(4,5-dimethyl-1,3-thiazol-2-yl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | Cc1nc(NC(=O)[C@@H]2CS[C@@]3(C)CCC(=O)N23)sc1C |
| InChI | InChI=1S/C13H17N3O2S2/c1-7-8(2)20-12(14-7)15-11(18)9-6-19-13(3)5-4-10(17)16(9)13/h9H,4-6H2,1-3H3,(H,14,15,18)/t9-,13-/m0/s1 |
| InChIKey | FSAATUCVBOXDCE-ZANVPECISA-N |
| XLogP | 2.15 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |