C15H19N3O4S2 — CID 31302770
ethyl 2-[[(3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 31302770) has the molecular formula C15H19N3O4S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is ethyl 2-[[(3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[(3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 31302770 |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | ethyl 2-[[(3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)[C@@H]2CS[C@]3(C)CCC(=O)N23)nc1C |
| InChI | InChI=1S/C15H19N3O4S2/c1-4-22-13(21)11-8(2)16-14(24-11)17-12(20)9-7-23-15(3)6-5-10(19)18(9)15/h9H,4-7H2,1-3H3,(H,16,17,20)/t9-,15+/m0/s1 |
| InChIKey | VRRRKDPDLWNTEH-BJOHPYRUSA-N |
| XLogP | 2.02 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |