C16H20N2O4S2 — CID 17468652
methyl 2-[(7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 17468652) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is methyl 2-[(7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 17468652 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | methyl 2-[(7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C2CSC3(C)CCC(=O)N23)sc(C)c1C |
| InChI | InChI=1S/C16H20N2O4S2/c1-8-9(2)24-14(12(8)15(21)22-4)17-13(20)10-7-23-16(3)6-5-11(19)18(10)16/h10H,5-7H2,1-4H3,(H,17,20) |
| InChIKey | OCYARQPFKYNGKO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |