C15H24N2O4S — CID 99809197
methyl (2R)-2-[[(3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl]amino]-3,3-dimethylbutanoate (PubChem CID 99809197) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is methyl (2R)-2-[[(3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl]amino]-3,3-dimethylbutanoate.
| Compound Name | methyl (2R)-2-[[(3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl]amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 99809197 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | methyl (2R)-2-[[(3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonyl]amino]-3,3-dimethylbutanoate |
| SMILES | COC(=O)[C@H](NC(=O)[C@H]1CS[C@]2(C)CCC(=O)N12)C(C)(C)C |
| InChI | InChI=1S/C15H24N2O4S/c1-14(2,3)11(13(20)21-5)16-12(19)9-8-22-15(4)7-6-10(18)17(9)15/h9,11H,6-8H2,1-5H3,(H,16,19)/t9-,11+,15-/m1/s1 |
| InChIKey | GAHBZFLGSTYFEW-BPYAMOTFSA-N |
| XLogP | 1.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |