C19H18N2O4 — CID 52530329
N-cyclopropyl-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-2-yloxyacetamide (PubChem CID 52530329) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-cyclopropyl-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 52530329 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-cyclopropyl-N-[(3R)-2,5-dioxopyrrolidin-3-yl]-2-naphthalen-2-yloxyacetamide |
| SMILES | O=C1C[C@@H](N(C(=O)COc2ccc3ccccc3c2)C2CC2)C(=O)N1 |
| InChI | InChI=1S/C19H18N2O4/c22-17-10-16(19(24)20-17)21(14-6-7-14)18(23)11-25-15-8-5-12-3-1-2-4-13(12)9-15/h1-5,8-9,14,16H,6-7,10-11H2,(H,20,22,24)/t16-/m1/s1 |
| InChIKey | TWDNMZGDNLWULI-MRXNPFEDSA-N |
| XLogP | 1.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|