C24H27N3O4 — CID 52536206
3,6,6-trimethyl-N-[(1S)-2-methyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-4-oxo-5,7-dihydro-1-benzofuran-2-carboxamide (PubChem CID 52536206) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 3,6,6-trimethyl-N-[(1S)-2-methyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-4-oxo-5,7-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | 3,6,6-trimethyl-N-[(1S)-2-methyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-4-oxo-5,7-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 52536206 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 3,6,6-trimethyl-N-[(1S)-2-methyl-1-(3-phenyl-1,2,4-oxadiazol-5-yl)propyl]-4-oxo-5,7-dihydro-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N[C@H](c2nc(-c3ccccc3)no2)C(C)C)oc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C24H27N3O4/c1-13(2)19(23-26-21(27-31-23)15-9-7-6-8-10-15)25-22(29)20-14(3)18-16(28)11-24(4,5)12-17(18)30-20/h6-10,13,19H,11-12H2,1-5H3,(H,25,29)/t19-/m0/s1 |
| InChIKey | NMZCNNAITKDDLG-IBGZPJMESA-N |
| XLogP | 4.92 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |