C19H26FN3O4 — CID 52536326
tert-butyl N-[2-[[(3S)-1-(2-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl]carbamate (PubChem CID 52536326) has the molecular formula C19H26FN3O4 and a molecular weight of 379.43 g/mol. Its IUPAC name is tert-butyl N-[2-[[(3S)-1-(2-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(3S)-1-(2-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 52536326 |
| Molecular Formula | C19H26FN3O4 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | tert-butyl N-[2-[[(3S)-1-(2-fluoro-4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl]carbamate |
| SMILES | Cc1ccc(N2C[C@@H](C(=O)NCCNC(=O)OC(C)(C)C)CC2=O)c(F)c1 |
| InChI | InChI=1S/C19H26FN3O4/c1-12-5-6-15(14(20)9-12)23-11-13(10-16(23)24)17(25)21-7-8-22-18(26)27-19(2,3)4/h5-6,9,13H,7-8,10-11H2,1-4H3,(H,21,25)(H,22,26)/t13-/m0/s1 |
| InChIKey | LCJGGNIEIDNNFU-ZDUSSCGKSA-N |
| XLogP | 2.13 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|