C21H23F2N3O4S — CID 55617125
1-(2,4-difluorophenyl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 55617125) has the molecular formula C21H23F2N3O4S and a molecular weight of 451.50 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55617125 |
| Molecular Formula | C21H23F2N3O4S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCNC(=O)C2CC(=O)N(c3ccc(F)cc3F)C2)c1 |
| InChI | InChI=1S/C21H23F2N3O4S/c1-13-3-4-14(2)19(9-13)31(29,30)25-8-7-24-21(28)15-10-20(27)26(12-15)18-6-5-16(22)11-17(18)23/h3-6,9,11,15,25H,7-8,10,12H2,1-2H3,(H,24,28) |
| InChIKey | RHTAZYBIWCFHME-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|