C15H16F2N2O4S — CID 119241557
2-[2-[[1-(2,4-difluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119241557) has the molecular formula C15H16F2N2O4S and a molecular weight of 358.37 g/mol. Its IUPAC name is 2-[2-[[1-(2,4-difluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[1-(2,4-difluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241557 |
| Molecular Formula | C15H16F2N2O4S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[2-[[1-(2,4-difluorophenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)C1CC(=O)N(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C15H16F2N2O4S/c16-10-1-2-12(11(17)6-10)19-7-9(5-13(19)20)15(23)18-3-4-24-8-14(21)22/h1-2,6,9H,3-5,7-8H2,(H,18,23)(H,21,22) |
| InChIKey | BFOJMXYQDSOUGX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|