C21H23F2N3O2 — CID 51938382
(3S)-1-(2,4-difluorophenyl)-N-[3-(N-methylanilino)propyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 51938382) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is (3S)-1-(2,4-difluorophenyl)-N-[3-(N-methylanilino)propyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(2,4-difluorophenyl)-N-[3-(N-methylanilino)propyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51938382 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (3S)-1-(2,4-difluorophenyl)-N-[3-(N-methylanilino)propyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN(CCCNC(=O)[C@H]1CC(=O)N(c2ccc(F)cc2F)C1)c1ccccc1 |
| InChI | InChI=1S/C21H23F2N3O2/c1-25(17-6-3-2-4-7-17)11-5-10-24-21(28)15-12-20(27)26(14-15)19-9-8-16(22)13-18(19)23/h2-4,6-9,13,15H,5,10-12,14H2,1H3,(H,24,28)/t15-/m0/s1 |
| InChIKey | PYUDCJYXENJHIL-HNNXBMFYSA-N |
| XLogP | 2.96 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|