C16H20N2O4S — CID 119242612
2-[2-[[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119242612) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 2-[2-[[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119242612 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[2-[[1-(4-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethylsulfanyl]acetic acid |
| SMILES | Cc1ccc(N2CC(C(=O)NCCSCC(=O)O)CC2=O)cc1 |
| InChI | InChI=1S/C16H20N2O4S/c1-11-2-4-13(5-3-11)18-9-12(8-14(18)19)16(22)17-6-7-23-10-15(20)21/h2-5,12H,6-10H2,1H3,(H,17,22)(H,20,21) |
| InChIKey | ASWJSEVARXJNNU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|