C19H29N3O4S — CID 108572293
1-tert-butyl-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 108572293) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-tert-butyl-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108572293 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-tert-butyl-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCNC(=O)C2CC(=O)N(C(C)(C)C)C2)c1 |
| InChI | InChI=1S/C19H29N3O4S/c1-13-6-7-14(2)16(10-13)27(25,26)21-9-8-20-18(24)15-11-17(23)22(12-15)19(3,4)5/h6-7,10,15,21H,8-9,11-12H2,1-5H3,(H,20,24) |
| InChIKey | CKESTEGCCKYKOV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|