C12H20F3NO4S2 — CID 52536545
1,1-dioxo-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]thiane-4-sulfonamide (PubChem CID 52536545) has the molecular formula C12H20F3NO4S2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 1,1-dioxo-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]thiane-4-sulfonamide.
| Compound Name | 1,1-dioxo-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]thiane-4-sulfonamide |
|---|---|
| PubChem CID | 52536545 |
| Molecular Formula | C12H20F3NO4S2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1,1-dioxo-N-[(1S,2R)-2-(trifluoromethyl)cyclohexyl]thiane-4-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)N[C@H]2CCCC[C@H]2C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H20F3NO4S2/c13-12(14,15)10-3-1-2-4-11(10)16-22(19,20)9-5-7-21(17,18)8-6-9/h9-11,16H,1-8H2/t10-,11+/m1/s1 |
| InChIKey | GCPYAEFAOFIJJQ-MNOVXSKESA-N |
| XLogP | 1.60 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |