C15H17N3O5 — CID 52537440
cis-(1R,2S)-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-2-nitrocyclopropane-1-carboxamide (PubChem CID 52537440) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is cis-(1R,2S)-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-2-nitrocyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 52537440 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | cis-(1R,2S)-N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-2-nitrocyclopropane-1-carboxamide |
| SMILES | COc1cc(NC(=O)[C@@H]2C[C@@H]2[N+](=O)[O-])ccc1N1CCCC1=O |
| InChI | InChI=1S/C15H17N3O5/c1-23-13-7-9(16-15(20)10-8-12(10)18(21)22)4-5-11(13)17-6-2-3-14(17)19/h4-5,7,10,12H,2-3,6,8H2,1H3,(H,16,20)/t10-,12+/m1/s1 |
| InChIKey | LCWDAVJEVJXZMP-PWSUYJOCSA-N |
| XLogP | 1.43 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|