C19H19N7O — CID 52538369
2-[(3R)-2-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-3,4-dihydro-1H-isoquinolin-3-yl]-5-methyl-1,3,4-oxadiazole (PubChem CID 52538369) has the molecular formula C19H19N7O and a molecular weight of 361.41 g/mol. Its IUPAC name is 2-[(3R)-2-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-3,4-dihydro-1H-isoquinolin-3-yl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-[(3R)-2-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-3,4-dihydro-1H-isoquinolin-3-yl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 52538369 |
| Molecular Formula | C19H19N7O |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-[(3R)-2-(5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-3,4-dihydro-1H-isoquinolin-3-yl]-5-methyl-1,3,4-oxadiazole |
| SMILES | CCc1cc(N2Cc3ccccc3C[C@@H]2c2nnc(C)o2)n2ncnc2n1 |
| InChI | InChI=1S/C19H19N7O/c1-3-15-9-17(26-19(22-15)20-11-21-26)25-10-14-7-5-4-6-13(14)8-16(25)18-24-23-12(2)27-18/h4-7,9,11,16H,3,8,10H2,1-2H3/t16-/m1/s1 |
| InChIKey | XWUKKIPHQFCOFQ-MRXNPFEDSA-N |
| XLogP | 2.68 |
| TPSA | 85.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |