C16H24F2N2O2S — CID 52539410
N-[[(2S)-1-butylpiperidin-2-yl]methyl]-3,4-difluorobenzenesulfonamide (PubChem CID 52539410) has the molecular formula C16H24F2N2O2S and a molecular weight of 346.44 g/mol. Its IUPAC name is N-[[(2S)-1-butylpiperidin-2-yl]methyl]-3,4-difluorobenzenesulfonamide.
| Compound Name | N-[[(2S)-1-butylpiperidin-2-yl]methyl]-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 52539410 |
| Molecular Formula | C16H24F2N2O2S |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[[(2S)-1-butylpiperidin-2-yl]methyl]-3,4-difluorobenzenesulfonamide |
| SMILES | CCCCN1CCCC[C@H]1CNS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H24F2N2O2S/c1-2-3-9-20-10-5-4-6-13(20)12-19-23(21,22)14-7-8-15(17)16(18)11-14/h7-8,11,13,19H,2-6,9-10,12H2,1H3/t13-/m0/s1 |
| InChIKey | VNGIVLTWZQTNCN-ZDUSSCGKSA-N |
| XLogP | 2.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |