C21H16ClN3O2 — CID 52554012
1-(4-chlorophenyl)-5-(furan-2-yl)-N-methyl-N-phenylpyrazole-3-carboxamide (PubChem CID 52554012) has the molecular formula C21H16ClN3O2 and a molecular weight of 377.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-(furan-2-yl)-N-methyl-N-phenylpyrazole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-5-(furan-2-yl)-N-methyl-N-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 52554012 |
| Molecular Formula | C21H16ClN3O2 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 1-(4-chlorophenyl)-5-(furan-2-yl)-N-methyl-N-phenylpyrazole-3-carboxamide |
| SMILES | CN(C(=O)c1cc(-c2ccco2)n(-c2ccc(Cl)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C21H16ClN3O2/c1-24(16-6-3-2-4-7-16)21(26)18-14-19(20-8-5-13-27-20)25(23-18)17-11-9-15(22)10-12-17/h2-14H,1H3 |
| InChIKey | MTUQSPMVXKFICB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |