C13H13N3O3S — CID 52560390
5-methyl-N-(2-methylsulfonylphenyl)pyrazine-2-carboxamide (PubChem CID 52560390) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 5-methyl-N-(2-methylsulfonylphenyl)pyrazine-2-carboxamide.
| Compound Name | 5-methyl-N-(2-methylsulfonylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 52560390 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 5-methyl-N-(2-methylsulfonylphenyl)pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ccccc2S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C13H13N3O3S/c1-9-7-15-11(8-14-9)13(17)16-10-5-3-4-6-12(10)20(2,18)19/h3-8H,1-2H3,(H,16,17) |
| InChIKey | BROFTMKIVUAVBW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |