C19H19N5O — CID 86814979
5-methyl-N-[2-(2-pyridin-2-ylethylamino)phenyl]pyrazine-2-carboxamide (PubChem CID 86814979) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 5-methyl-N-[2-(2-pyridin-2-ylethylamino)phenyl]pyrazine-2-carboxamide.
| Compound Name | 5-methyl-N-[2-(2-pyridin-2-ylethylamino)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 86814979 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 5-methyl-N-[2-(2-pyridin-2-ylethylamino)phenyl]pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ccccc2NCCc2ccccn2)cn1 |
| InChI | InChI=1S/C19H19N5O/c1-14-12-23-18(13-22-14)19(25)24-17-8-3-2-7-16(17)21-11-9-15-6-4-5-10-20-15/h2-8,10,12-13,21H,9,11H2,1H3,(H,24,25) |
| InChIKey | FNNXVVHRGSOKCD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |