C23H17F3N4O3 — CID 52585255
ethyl 1-[4-(quinolin-5-ylcarbamoyl)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 52585255) has the molecular formula C23H17F3N4O3 and a molecular weight of 454.41 g/mol. Its IUPAC name is ethyl 1-[4-(quinolin-5-ylcarbamoyl)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[4-(quinolin-5-ylcarbamoyl)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 52585255 |
| Molecular Formula | C23H17F3N4O3 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | ethyl 1-[4-(quinolin-5-ylcarbamoyl)phenyl]-5-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(C(=O)Nc3cccc4ncccc34)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C23H17F3N4O3/c1-2-33-22(32)17-13-28-30(20(17)23(24,25)26)15-10-8-14(9-11-15)21(31)29-19-7-3-6-18-16(19)5-4-12-27-18/h3-13H,2H2,1H3,(H,29,31) |
| InChIKey | HVSHZUAJZSIVGC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |