C15H24N2 — CID 525867
N,N-dimethyl-N'-pentyl-2-phenylethanimidamide (PubChem CID 525867) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N,N-dimethyl-N'-pentyl-2-phenylethanimidamide.
| Compound Name | N,N-dimethyl-N'-pentyl-2-phenylethanimidamide |
|---|---|
| PubChem CID | 525867 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N,N-dimethyl-N'-pentyl-2-phenylethanimidamide |
| SMILES | CCCCC/N=C(/Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C15H24N2/c1-4-5-9-12-16-15(17(2)3)13-14-10-7-6-8-11-14/h6-8,10-11H,4-5,9,12-13H2,1-3H3/b16-15- |
| InChIKey | SACBYZLORDMQDQ-NXVVXOECSA-N |
| XLogP | 3.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|