C28H37BrO7 — CID 5260006
[8,12,14,17-tetrahydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-yl] 4-bromobenzoate (PubChem CID 5260006) has the molecular formula C28H37BrO7 and a molecular weight of 565.50 g/mol. Its IUPAC name is [8,12,14,17-tetrahydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-yl] 4-bromobenzoate.
| Compound Name | [8,12,14,17-tetrahydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 5260006 |
| Molecular Formula | C28H37BrO7 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | [8,12,14,17-tetrahydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-yl] 4-bromobenzoate |
| SMILES | CC(O)C1(O)CCC2(O)C3(O)CC=C4CC(OC(=O)c5ccc(Br)cc5)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C28H37BrO7/c1-16(30)26(33)12-13-28(35)25(26,3)22(31)15-21-24(2)10-9-20(14-18(24)8-11-27(21,28)34)36-23(32)17-4-6-19(29)7-5-17/h4-8,16,20-22,30-31,33-35H,9-15H2,1-3H3 |
| InChIKey | SGMHYNLSCKURMC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|