C21H34O7 — CID 162940540
(3S,8S,9R,10R,11S,12S,13R,14R,17S)-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthrene-3,8,11,12,14,17-hexol (PubChem CID 162940540) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is (3S,8S,9R,10R,11S,12S,13R,14R,17S)-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthrene-3,8,11,12,14,17-hexol.
| Compound Name | (3S,8S,9R,10R,11S,12S,13R,14R,17S)-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthrene-3,8,11,12,14,17-hexol |
|---|---|
| PubChem CID | 162940540 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (3S,8S,9R,10R,11S,12S,13R,14R,17S)-17-[(1R)-1-hydroxyethyl]-10,13-dimethyl-1,2,3,4,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthrene-3,8,11,12,14,17-hexol |
| SMILES | C[C@@H](O)[C@]1(O)CC[C@@]2(O)[C@]1(C)[C@H](O)[C@@H](O)[C@H]1[C@@]3(C)CC[C@H](O)CC3=CC[C@]12O |
| InChI | InChI=1S/C21H34O7/c1-11(22)19(26)8-9-21(28)18(19,3)16(25)14(24)15-17(2)6-5-13(23)10-12(17)4-7-20(15,21)27/h4,11,13-16,22-28H,5-10H2,1-3H3/t11-,13+,14+,15+,16-,17+,18-,19-,20+,21-/m1/s1 |
| InChIKey | JBQLQIMCKFDOHK-FDDFZKMNSA-N |
| XLogP | -0.41 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|