C12H22N4 — CID 5260124
5-heptyl-6-methylpyrimidine-2,4-diamine (PubChem CID 5260124) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 5-heptyl-6-methylpyrimidine-2,4-diamine.
| Compound Name | 5-heptyl-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 5260124 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 5-heptyl-6-methylpyrimidine-2,4-diamine |
| SMILES | CCCCCCCc1c(C)nc(N)nc1N |
| InChI | InChI=1S/C12H22N4/c1-3-4-5-6-7-8-10-9(2)15-12(14)16-11(10)13/h3-8H2,1-2H3,(H4,13,14,15,16) |
| InChIKey | LCYHNZFYRQBXFR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|