C13H20N4O4 — CID 5260147
2-[3-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)propanoylamino]-3-methylpentanoate (PubChem CID 5260147) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[3-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)propanoylamino]-3-methylpentanoate.
| Compound Name | 2-[3-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)propanoylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 5260147 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-[3-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)propanoylamino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)CC[n+]1ccc(N)[nH]c1=O)C(=O)[O-] |
| InChI | InChI=1S/C13H20N4O4/c1-3-8(2)11(12(19)20)16-10(18)5-7-17-6-4-9(14)15-13(17)21/h4,6,8,11H,3,5,7H2,1-2H3,(H4,14,15,16,18,19,20,21) |
| InChIKey | MNOQREXUXCIOQE-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|