C13H21N4O4+ — CID 5260148
2-[3-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)propanoylamino]-3-methylpentanoic acid (PubChem CID 5260148) has the molecular formula C13H21N4O4+ and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-[3-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)propanoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[3-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)propanoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 5260148 |
| Molecular Formula | C13H21N4O4+ |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[3-(6-amino-2-oxo-1H-pyrimidin-3-ium-3-yl)propanoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)CC[n+]1ccc(N)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C13H20N4O4/c1-3-8(2)11(12(19)20)16-10(18)5-7-17-6-4-9(14)15-13(17)21/h4,6,8,11H,3,5,7H2,1-2H3,(H4,14,15,16,18,19,20,21)/p+1 |
| InChIKey | MNOQREXUXCIOQE-UHFFFAOYSA-O |
| XLogP | -0.75 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|