C19H17F2N3O3 — CID 52606481
N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide (PubChem CID 52606481) has the molecular formula C19H17F2N3O3 and a molecular weight of 373.36 g/mol. Its IUPAC name is N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide.
| Compound Name | N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 52606481 |
| Molecular Formula | C19H17F2N3O3 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide |
| SMILES | C[C@@H](NC(=O)Cn1ncc2ccccc2c1=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C19H17F2N3O3/c1-12(13-6-4-7-15(9-13)27-19(20)21)23-17(25)11-24-18(26)16-8-3-2-5-14(16)10-22-24/h2-10,12,19H,11H2,1H3,(H,23,25)/t12-/m1/s1 |
| InChIKey | YDEPLJOYMFVPJE-GFCCVEGCSA-N |
| XLogP | 2.88 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |