C24H28N4O2 — CID 93242311
N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide (PubChem CID 93242311) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide.
| Compound Name | N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 93242311 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[(1S)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-(1-oxophthalazin-2-yl)acetamide |
| SMILES | CC1CCN(c2ccc([C@H](C)NC(=O)Cn3ncc4ccccc4c3=O)cc2)CC1 |
| InChI | InChI=1S/C24H28N4O2/c1-17-11-13-27(14-12-17)21-9-7-19(8-10-21)18(2)26-23(29)16-28-24(30)22-6-4-3-5-20(22)15-25-28/h3-10,15,17-18H,11-14,16H2,1-2H3,(H,26,29)/t18-/m0/s1 |
| InChIKey | IXFBNKSQRPIJAS-SFHVURJKSA-N |
| XLogP | 3.51 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|