C19H23BrN2O3S — CID 52611501
N-[2-(4-bromophenyl)-2-methylpropyl]-3-(methanesulfonamido)-4-methylbenzamide (PubChem CID 52611501) has the molecular formula C19H23BrN2O3S and a molecular weight of 439.38 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-2-methylpropyl]-3-(methanesulfonamido)-4-methylbenzamide.
| Compound Name | N-[2-(4-bromophenyl)-2-methylpropyl]-3-(methanesulfonamido)-4-methylbenzamide |
|---|---|
| PubChem CID | 52611501 |
| Molecular Formula | C19H23BrN2O3S |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-[2-(4-bromophenyl)-2-methylpropyl]-3-(methanesulfonamido)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(C)(C)c2ccc(Br)cc2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C19H23BrN2O3S/c1-13-5-6-14(11-17(13)22-26(4,24)25)18(23)21-12-19(2,3)15-7-9-16(20)10-8-15/h5-11,22H,12H2,1-4H3,(H,21,23) |
| InChIKey | XGMDYFDEAOLCKM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |