C29H37N3O6 — CID 5261325
5-(4-butoxy-3-ethoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 5261325) has the molecular formula C29H37N3O6 and a molecular weight of 523.63 g/mol. Its IUPAC name is 5-(4-butoxy-3-ethoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(4-butoxy-3-ethoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5261325 |
| Molecular Formula | C29H37N3O6 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 5-(4-butoxy-3-ethoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc(C2C(=C(O)c3ccncc3)C(=O)C(=O)N2CCCN2CCOCC2)cc1OCC |
| InChI | InChI=1S/C29H37N3O6/c1-3-5-17-38-23-8-7-22(20-24(23)37-4-2)26-25(27(33)21-9-11-30-12-10-21)28(34)29(35)32(26)14-6-13-31-15-18-36-19-16-31/h7-12,20,26,33H,3-6,13-19H2,1-2H3 |
| InChIKey | BSAXWOMMVNBPPF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|