C30H39N3O6 — CID 6314675
(4E)-5-(3-ethoxy-4-pentoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 6314675) has the molecular formula C30H39N3O6 and a molecular weight of 537.66 g/mol. Its IUPAC name is (4E)-5-(3-ethoxy-4-pentoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-ethoxy-4-pentoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6314675 |
| Molecular Formula | C30H39N3O6 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | (4E)-5-(3-ethoxy-4-pentoxyphenyl)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(C2/C(=C(\O)c3ccncc3)C(=O)C(=O)N2CCCN2CCOCC2)cc1OCC |
| InChI | InChI=1S/C30H39N3O6/c1-3-5-6-18-39-24-9-8-23(21-25(24)38-4-2)27-26(28(34)22-10-12-31-13-11-22)29(35)30(36)33(27)15-7-14-32-16-19-37-20-17-32/h8-13,21,27,34H,3-7,14-20H2,1-2H3/b28-26+ |
| InChIKey | ZRWBWYFIOVQWLI-BYCLXTJYSA-N |
| XLogP | 4.19 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|