methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate

C12H12N2O4 — CID 52618291

IUPACmethyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate
SMILESCOC(=O)c1cccc(OCc2noc(C)n2)c1
InChIInChI=1S/C12H12N2O4/c1-8-13-11(14-18-8)7-17-10-5-3-4-9(6-10)12(15)16-2/h3-6H,7H2,1-2H3
InChIKeyDWLIYPXSZBQWCP-UHFFFAOYSA-N
MW248.24 g/mol
LogP1.74
Rot. Bonds4

About methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate

methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate (PubChem CID 52618291) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate.

Molecular Properties

Compound Namemethyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate
PubChem CID52618291
Molecular FormulaC12H12N2O4
Molecular Weight248.24 g/mol
Exact Mass248.08
IUPAC Namemethyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate
SMILESCOC(=O)c1cccc(OCc2noc(C)n2)c1
InChIInChI=1S/C12H12N2O4/c1-8-13-11(14-18-8)7-17-10-5-3-4-9(6-10)12(15)16-2/h3-6H,7H2,1-2H3
InChIKeyDWLIYPXSZBQWCP-UHFFFAOYSA-N
XLogP1.74
TPSA74.45 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.24
LogP ≤ 51.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate?
The IUPAC name of methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate (CID 52618291) is methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate.
What is the SMILES notation for methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate?
The canonical SMILES for methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate is COC(=O)c1cccc(OCc2noc(C)n2)c1.
What is the InChIKey of methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate?
The InChIKey is DWLIYPXSZBQWCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O4/c1-8-13-11(14-18-8)7-17-10-5-3-4-9(6-10)12(15)16-2/h3-6H,7H2,1-2H3.
What are the key properties of methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate?
methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate has a molecular weight of 248.24 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoate is sourced from PubChem (CID 52618291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).