C20H16N2O8 — CID 5263934
N-(6-nitro-1,3-benzodioxol-5-yl)-2-oxo-7-propoxychromene-3-carboxamide (PubChem CID 5263934) has the molecular formula C20H16N2O8 and a molecular weight of 412.35 g/mol. Its IUPAC name is N-(6-nitro-1,3-benzodioxol-5-yl)-2-oxo-7-propoxychromene-3-carboxamide.
| Compound Name | N-(6-nitro-1,3-benzodioxol-5-yl)-2-oxo-7-propoxychromene-3-carboxamide |
|---|---|
| PubChem CID | 5263934 |
| Molecular Formula | C20H16N2O8 |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | N-(6-nitro-1,3-benzodioxol-5-yl)-2-oxo-7-propoxychromene-3-carboxamide |
| SMILES | CCCOc1ccc2cc(C(=O)Nc3cc4c(cc3[N+](=O)[O-])OCO4)c(=O)oc2c1 |
| InChI | InChI=1S/C20H16N2O8/c1-2-5-27-12-4-3-11-6-13(20(24)30-16(11)7-12)19(23)21-14-8-17-18(29-10-28-17)9-15(14)22(25)26/h3-4,6-9H,2,5,10H2,1H3,(H,21,23) |
| InChIKey | UPIIVBAGFRJQLN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|