C30H36N4O2S2 — CID 5264219
6-(4-benzylpiperidin-1-yl)-5-[(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 5264219) has the molecular formula C30H36N4O2S2 and a molecular weight of 548.78 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-5-[(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-5-[(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5264219 |
| Molecular Formula | C30H36N4O2S2 |
| Molecular Weight | 548.78 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-5-[(3-hexyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCCCN1C(=O)C(=Cc2c(C)c(C#N)c(=O)n(C)c2N2CCC(Cc3ccccc3)CC2)SC1=S |
| InChI | InChI=1S/C30H36N4O2S2/c1-4-5-6-10-15-34-29(36)26(38-30(34)37)19-24-21(2)25(20-31)28(35)32(3)27(24)33-16-13-23(14-17-33)18-22-11-8-7-9-12-22/h7-9,11-12,19,23H,4-6,10,13-18H2,1-3H3 |
| InChIKey | AUYXAGUEMQERPH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.78 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|