C33H42N4O2S2 — CID 6315792
6-(4-benzylpiperidin-1-yl)-1-ethyl-4-methyl-5-[(Z)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile (PubChem CID 6315792) has the molecular formula C33H42N4O2S2 and a molecular weight of 590.86 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-1-ethyl-4-methyl-5-[(Z)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-1-ethyl-4-methyl-5-[(Z)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6315792 |
| Molecular Formula | C33H42N4O2S2 |
| Molecular Weight | 590.86 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-1-ethyl-4-methyl-5-[(Z)-(3-octyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCCCCCN1C(=O)/C(=C/c2c(C)c(C#N)c(=O)n(CC)c2N2CCC(Cc3ccccc3)CC2)SC1=S |
| InChI | InChI=1S/C33H42N4O2S2/c1-4-6-7-8-9-13-18-37-32(39)29(41-33(37)40)22-27-24(3)28(23-34)31(38)36(5-2)30(27)35-19-16-26(17-20-35)21-25-14-11-10-12-15-25/h10-12,14-15,22,26H,4-9,13,16-21H2,1-3H3/b29-22- |
| InChIKey | SYGMFYQMSCEWKP-IADYIPOJSA-N |
| XLogP | 7.07 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.86 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|